C14H24N2O3 — CID 174148604
tert-butyl (1S,2S,5R)-2-(2-methoxyethenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 174148604) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl (1S,2S,5R)-2-(2-methoxyethenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1S,2S,5R)-2-(2-methoxyethenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 174148604 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | tert-butyl (1S,2S,5R)-2-(2-methoxyethenyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COC=C[C@@H]1NC[C@H]2CC[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-14(2,3)19-13(17)16-10-5-6-12(16)11(15-9-10)7-8-18-4/h7-8,10-12,15H,5-6,9H2,1-4H3/t10-,11+,12+/m1/s1 |
| InChIKey | AFXKDJAWBVVCKT-WOPDTQHZSA-N |
| XLogP | 1.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|