C40H40Si — CID 174151841
[3-[4-[3-[4-[(4aZ,6E)-9,10,11,11a-tetrahydro-8H-benzo[9]annulen-7-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 174151841) has the molecular formula C40H40Si and a molecular weight of 548.85 g/mol. Its IUPAC name is [3-[4-[3-[4-[(4aZ,6E)-9,10,11,11a-tetrahydro-8H-benzo[9]annulen-7-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [3-[4-[3-[4-[(4aZ,6E)-9,10,11,11a-tetrahydro-8H-benzo[9]annulen-7-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 174151841 |
| Molecular Formula | C40H40Si |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | [3-[4-[3-[4-[(4aZ,6E)-9,10,11,11a-tetrahydro-8H-benzo[9]annulen-7-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc(-c2ccc(-c3cccc(-c4ccc(/C5=C/C=C6/C=CC=CC6CCCC5)cc4)c3)cc2)c1 |
| InChI | InChI=1S/C40H40Si/c1-41(2,3)40-17-9-16-39(29-40)36-26-24-35(25-27-36)38-15-8-14-37(28-38)34-22-20-33(21-23-34)32-13-7-5-11-30-10-4-6-12-31(30)18-19-32/h4,6,8-10,12,14-30H,5,7,11,13H2,1-3H3/b31-18-,32-19+ |
| InChIKey | BMYDEOCHZZRCKV-ACZHWQJQSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|