C18H28O6 — CID 174155515
5-butoxybenzene-1,3-dicarbaldehyde;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 174155515) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 5-butoxybenzene-1,3-dicarbaldehyde;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 5-butoxybenzene-1,3-dicarbaldehyde;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 174155515 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 5-butoxybenzene-1,3-dicarbaldehyde;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCC(CO)(CO)CO.CCCCOc1cc(C=O)cc(C=O)c1 |
| InChI | InChI=1S/C12H14O3.C6H14O3/c1-2-3-4-15-12-6-10(8-13)5-11(7-12)9-14;1-2-6(3-7,4-8)5-9/h5-9H,2-4H2,1H3;7-9H,2-5H2,1H3 |
| InChIKey | LDVIHEJWVZVSGJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|