C23H24N6O5S — CID 174158501
1-(2,6-dimethoxyphenyl)-5-ethenyl-2-(6-ethoxy-2-pyridinyl)-6-[(sulfinoamino)methyl]imidazo[4,5-b]pyrazine (PubChem CID 174158501) has the molecular formula C23H24N6O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-5-ethenyl-2-(6-ethoxy-2-pyridinyl)-6-[(sulfinoamino)methyl]imidazo[4,5-b]pyrazine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-5-ethenyl-2-(6-ethoxy-2-pyridinyl)-6-[(sulfinoamino)methyl]imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 174158501 |
| Molecular Formula | C23H24N6O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-5-ethenyl-2-(6-ethoxy-2-pyridinyl)-6-[(sulfinoamino)methyl]imidazo[4,5-b]pyrazine |
| SMILES | C=Cc1nc2nc(-c3cccc(OCC)n3)n(-c3c(OC)cccc3OC)c2nc1CNS(=O)O |
| InChI | InChI=1S/C23H24N6O5S/c1-5-14-16(13-24-35(30)31)27-23-21(26-14)28-22(15-9-7-12-19(25-15)34-6-2)29(23)20-17(32-3)10-8-11-18(20)33-4/h5,7-12,24H,1,6,13H2,2-4H3,(H,30,31) |
| InChIKey | DFQGUYFKXLLMLF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|