C49H50O13 — CID 174160126
[3,4,5-tribenzoyloxy-6-[4-(2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl)but-3-en-2-yloxy]oxan-2-yl]methyl benzoate (PubChem CID 174160126) has the molecular formula C49H50O13 and a molecular weight of 846.93 g/mol. Its IUPAC name is [3,4,5-tribenzoyloxy-6-[4-(2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl)but-3-en-2-yloxy]oxan-2-yl]methyl benzoate.
| Compound Name | [3,4,5-tribenzoyloxy-6-[4-(2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl)but-3-en-2-yloxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 174160126 |
| Molecular Formula | C49H50O13 |
| Molecular Weight | 846.93 g/mol |
| Exact Mass | 846.33 |
| IUPAC Name | [3,4,5-tribenzoyloxy-6-[4-(2',2',6'-trimethylspiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-yl)but-3-en-2-yloxy]oxan-2-yl]methyl benzoate |
| SMILES | CC(C=CC12OC1(C)CC1(CC2(C)C)OCCO1)OC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C49H50O13/c1-32(25-26-49-46(2,3)30-48(55-27-28-56-48)31-47(49,4)62-49)57-45-40(61-44(53)36-23-15-8-16-24-36)39(60-43(52)35-21-13-7-14-22-35)38(59-42(51)34-19-11-6-12-20-34)37(58-45)29-54-41(50)33-17-9-5-10-18-33/h5-26,32,37-40,45H,27-31H2,1-4H3 |
| InChIKey | GLGMUEDFGDDWCO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 154.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.93 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|