C19H18ClFN4O — CID 174161437
4-[[5-(4-chloro-2-methoxyanilino)-4-methyl-3-pyridinyl]methyl]-3-fluoropyridin-2-amine (PubChem CID 174161437) has the molecular formula C19H18ClFN4O and a molecular weight of 372.83 g/mol. Its IUPAC name is 4-[[5-(4-chloro-2-methoxyanilino)-4-methyl-3-pyridinyl]methyl]-3-fluoropyridin-2-amine.
| Compound Name | 4-[[5-(4-chloro-2-methoxyanilino)-4-methyl-3-pyridinyl]methyl]-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 174161437 |
| Molecular Formula | C19H18ClFN4O |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[[5-(4-chloro-2-methoxyanilino)-4-methyl-3-pyridinyl]methyl]-3-fluoropyridin-2-amine |
| SMILES | COc1cc(Cl)ccc1Nc1cncc(Cc2ccnc(N)c2F)c1C |
| InChI | InChI=1S/C19H18ClFN4O/c1-11-13(7-12-5-6-24-19(22)18(12)21)9-23-10-16(11)25-15-4-3-14(20)8-17(15)26-2/h3-6,8-10,25H,7H2,1-2H3,(H2,22,24) |
| InChIKey | QPUQCBPWLRLPRD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |