C18H21N3O2 — CID 174165529
(Z)-3-(4-formamido-3,5-dimethyl-1H-pyrrol-2-yl)-2-methyl-N-(4-methylphenyl)prop-2-enamide (PubChem CID 174165529) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (Z)-3-(4-formamido-3,5-dimethyl-1H-pyrrol-2-yl)-2-methyl-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-formamido-3,5-dimethyl-1H-pyrrol-2-yl)-2-methyl-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 174165529 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (Z)-3-(4-formamido-3,5-dimethyl-1H-pyrrol-2-yl)-2-methyl-N-(4-methylphenyl)prop-2-enamide |
| SMILES | C/C(=C/c1[nH]c(C)c(NC=O)c1C)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-11-5-7-15(8-6-11)21-18(23)12(2)9-16-13(3)17(19-10-22)14(4)20-16/h5-10,20H,1-4H3,(H,19,22)(H,21,23)/b12-9- |
| InChIKey | RBLSEHKRZYPYLC-XFXZXTDPSA-N |
| XLogP | 3.55 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|