C10H11Cl2N7O2 — CID 174167061
(3R)-3-(azidomethyl)-4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylic acid (PubChem CID 174167061) has the molecular formula C10H11Cl2N7O2 and a molecular weight of 332.15 g/mol. Its IUPAC name is (3R)-3-(azidomethyl)-4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylic acid.
| Compound Name | (3R)-3-(azidomethyl)-4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174167061 |
| Molecular Formula | C10H11Cl2N7O2 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (3R)-3-(azidomethyl)-4-(3,6-dichloropyridazin-4-yl)piperazine-1-carboxylic acid |
| SMILES | [N-]=[N+]=NC[C@H]1CN(C(=O)O)CCN1c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C10H11Cl2N7O2/c11-8-3-7(9(12)16-15-8)19-2-1-18(10(20)21)5-6(19)4-14-17-13/h3,6H,1-2,4-5H2,(H,20,21)/t6-/m0/s1 |
| InChIKey | AUXKCXJRPCHJJC-LURJTMIESA-N |
| XLogP | 2.26 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|