C52H31N5O5S2 — CID 174171144
6-[4-(2-phenyl-1,3-benzothiazol-5-yl)-6-[4-(3-phenylcarbazol-9-yl)dibenzothiophen-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 174171144) has the molecular formula C52H31N5O5S2 and a molecular weight of 869.98 g/mol. Its IUPAC name is 6-[4-(2-phenyl-1,3-benzothiazol-5-yl)-6-[4-(3-phenylcarbazol-9-yl)dibenzothiophen-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-(2-phenyl-1,3-benzothiazol-5-yl)-6-[4-(3-phenylcarbazol-9-yl)dibenzothiophen-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174171144 |
| Molecular Formula | C52H31N5O5S2 |
| Molecular Weight | 869.98 g/mol |
| Exact Mass | 869.18 |
| IUPAC Name | 6-[4-(2-phenyl-1,3-benzothiazol-5-yl)-6-[4-(3-phenylcarbazol-9-yl)dibenzothiophen-1-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2nc(-c3ccc4sc(-c5ccccc5)nc4c3)nc(-c3ccc(-n4c5ccccc5c5cc(-c6ccccc6)ccc54)c4sc5ccccc5c34)n2)c(O)c1O |
| InChI | InChI=1S/C52H31N5O5S2/c58-43-42(44(59)46(61)47(62)45(43)60)51-55-49(30-20-24-40-35(26-30)53-52(64-40)28-13-5-2-6-14-28)54-50(56-51)33-21-23-38(48-41(33)32-16-8-10-18-39(32)63-48)57-36-17-9-7-15-31(36)34-25-29(19-22-37(34)57)27-11-3-1-4-12-27/h1-26,58-62H |
| InChIKey | OIGWKICQRLTWQC-UHFFFAOYSA-N |
| XLogP | 12.81 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.98 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|