C24H30BN3O5S — CID 174171872
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]sulfonylurea (PubChem CID 174171872) has the molecular formula C24H30BN3O5S and a molecular weight of 483.40 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]sulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 174171872 |
| Molecular Formula | C24H30BN3O5S |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]sulfonylurea |
| SMILES | CN1CCOB(c2cccc(S(=O)(=O)NC(=O)Nc3c4c(cc5c3CCC5)CCC4)c2)OCC1 |
| InChI | InChI=1S/C24H30BN3O5S/c1-28-11-13-32-25(33-14-12-28)19-7-4-8-20(16-19)34(30,31)27-24(29)26-23-21-9-2-5-17(21)15-18-6-3-10-22(18)23/h4,7-8,15-16H,2-3,5-6,9-14H2,1H3,(H2,26,27,29) |
| InChIKey | OPAMVXQKAKPCHZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|