C30H23F3N2O3S — CID 161100934
deca-1,2,3,4,5,6,7,8,9-nonaene;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylurea (PubChem CID 161100934) has the molecular formula C30H23F3N2O3S and a molecular weight of 548.59 g/mol. Its IUPAC name is deca-1,2,3,4,5,6,7,8,9-nonaene;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylurea.
| Compound Name | deca-1,2,3,4,5,6,7,8,9-nonaene;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 161100934 |
| Molecular Formula | C30H23F3N2O3S |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | deca-1,2,3,4,5,6,7,8,9-nonaene;1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylurea |
| SMILES | C=C=C=C=C=C=C=C=C=C.O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O3S.C10H4/c21-20(22,23)14-6-3-7-15(11-14)29(27,28)25-19(26)24-18-16-8-1-4-12(16)10-13-5-2-9-17(13)18;1-3-5-7-9-10-8-6-4-2/h3,6-7,10-11H,1-2,4-5,8-9H2,(H2,24,25,26);1-2H2 |
| InChIKey | UIKIXBKIPFCXHU-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |