C22H29N3O — CID 174172980
4-[[ethyl(methyl)amino]methylideneamino]-2,3,5-trimethyl-N-(2-phenylethyl)benzamide (PubChem CID 174172980) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-[[ethyl(methyl)amino]methylideneamino]-2,3,5-trimethyl-N-(2-phenylethyl)benzamide.
| Compound Name | 4-[[ethyl(methyl)amino]methylideneamino]-2,3,5-trimethyl-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 174172980 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 4-[[ethyl(methyl)amino]methylideneamino]-2,3,5-trimethyl-N-(2-phenylethyl)benzamide |
| SMILES | CCN(C)/C=N/c1c(C)cc(C(=O)NCCc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C22H29N3O/c1-6-25(5)15-24-21-16(2)14-20(17(3)18(21)4)22(26)23-13-12-19-10-8-7-9-11-19/h7-11,14-15H,6,12-13H2,1-5H3,(H,23,26)/b24-15+ |
| InChIKey | DZKBSKVBIVWZPY-BUVRLJJBSA-N |
| XLogP | 4.20 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|