C15H14ClFN2O4 — CID 174173793
4-[2-(4-chloro-2-fluorophenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 174173793) has the molecular formula C15H14ClFN2O4 and a molecular weight of 340.74 g/mol. Its IUPAC name is 4-[2-(4-chloro-2-fluorophenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[2-(4-chloro-2-fluorophenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 174173793 |
| Molecular Formula | C15H14ClFN2O4 |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-[2-(4-chloro-2-fluorophenyl)ethoxy]-5-(methylcarbamoyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CNC(=O)c1[nH]c(C(=O)O)cc1OCCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H14ClFN2O4/c1-18-14(20)13-12(7-11(19-13)15(21)22)23-5-4-8-2-3-9(16)6-10(8)17/h2-3,6-7,19H,4-5H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | QREFVOJDFVZNPJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |