C11H18FN3O2 — CID 174174995
ethyl 7-fluoro-5-propyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylate (PubChem CID 174174995) has the molecular formula C11H18FN3O2 and a molecular weight of 243.28 g/mol. Its IUPAC name is ethyl 7-fluoro-5-propyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylate.
| Compound Name | ethyl 7-fluoro-5-propyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylate |
|---|---|
| PubChem CID | 174174995 |
| Molecular Formula | C11H18FN3O2 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | ethyl 7-fluoro-5-propyl-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylate |
| SMILES | CCCC1CC(F)C2N=C(C(=O)OCC)NN12 |
| InChI | InChI=1S/C11H18FN3O2/c1-3-5-7-6-8(12)10-13-9(14-15(7)10)11(16)17-4-2/h7-8,10H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | HIOFYDFZZRPENI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |