C7H11IN2O2 — CID 142704352
ethyl 5-ethyl-1λ3-ioda-2,4-diazacyclopenta-2,5-diene-3-carboxylate (PubChem CID 142704352) has the molecular formula C7H11IN2O2 and a molecular weight of 282.08 g/mol. Its IUPAC name is ethyl 5-ethyl-1λ3-ioda-2,4-diazacyclopenta-2,5-diene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-1λ3-ioda-2,4-diazacyclopenta-2,5-diene-3-carboxylate |
|---|---|
| PubChem CID | 142704352 |
| Molecular Formula | C7H11IN2O2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | ethyl 5-ethyl-1λ3-ioda-2,4-diazacyclopenta-2,5-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=NI=C(CC)N1 |
| InChI | InChI=1S/C7H11IN2O2/c1-3-5-8-10-6(9-5)7(11)12-4-2/h3-4H2,1-2H3,(H,9,10) |
| InChIKey | IYHZGVCRHFOUJS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|