C9H14F3NO4 — CID 174175671
2-(methylamino)hex-5-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 174175671) has the molecular formula C9H14F3NO4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 2-(methylamino)hex-5-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(methylamino)hex-5-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174175671 |
| Molecular Formula | C9H14F3NO4 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-(methylamino)hex-5-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C=CCCC(NC)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H13NO2.C2HF3O2/c1-3-4-5-6(8-2)7(9)10;3-2(4,5)1(6)7/h3,6,8H,1,4-5H2,2H3,(H,9,10);(H,6,7) |
| InChIKey | SAIFTTQMOROYLH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|