C9H14F3NO2 — CID 104656057
2-methyl-2-(2,2,2-trifluoroethylamino)hex-5-enoic acid (PubChem CID 104656057) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is 2-methyl-2-(2,2,2-trifluoroethylamino)hex-5-enoic acid.
| Compound Name | 2-methyl-2-(2,2,2-trifluoroethylamino)hex-5-enoic acid |
|---|---|
| PubChem CID | 104656057 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-methyl-2-(2,2,2-trifluoroethylamino)hex-5-enoic acid |
| SMILES | C=CCCC(C)(NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H14F3NO2/c1-3-4-5-8(2,7(14)15)13-6-9(10,11)12/h3,13H,1,4-6H2,2H3,(H,14,15) |
| InChIKey | VNTWRCNDVBGJSE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|