C21H25F3N4O4 — CID 174178070
(3R)-3-[(3-amino-2-methanimidoylphenyl)methyl]-1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 174178070) has the molecular formula C21H25F3N4O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is (3R)-3-[(3-amino-2-methanimidoylphenyl)methyl]-1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (3R)-3-[(3-amino-2-methanimidoylphenyl)methyl]-1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174178070 |
| Molecular Formula | C21H25F3N4O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (3R)-3-[(3-amino-2-methanimidoylphenyl)methyl]-1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | [H]/N=C/c1c(N)cccc1C[C@H]1C(=O)N(C(=O)NC(C2CCCCC2)C(F)(F)F)C1C(=O)O |
| InChI | InChI=1S/C21H25F3N4O4/c22-21(23,24)17(11-5-2-1-3-6-11)27-20(32)28-16(19(30)31)13(18(28)29)9-12-7-4-8-15(26)14(12)10-25/h4,7-8,10-11,13,16-17,25H,1-3,5-6,9,26H2,(H,27,32)(H,30,31)/b25-10+/t13-,16?,17?/m1/s1 |
| InChIKey | BUKFUULRZIBTEB-MCHBZPFLSA-N |
| XLogP | 2.94 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|