C23H22F2N2O2 — CID 174178429
[5-[4-(1,1-difluoroethyl)phenoxy]naphthalen-2-yl]-piperazin-1-ylmethanone (PubChem CID 174178429) has the molecular formula C23H22F2N2O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is [5-[4-(1,1-difluoroethyl)phenoxy]naphthalen-2-yl]-piperazin-1-ylmethanone.
| Compound Name | [5-[4-(1,1-difluoroethyl)phenoxy]naphthalen-2-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 174178429 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [5-[4-(1,1-difluoroethyl)phenoxy]naphthalen-2-yl]-piperazin-1-ylmethanone |
| SMILES | CC(F)(F)c1ccc(Oc2cccc3cc(C(=O)N4CCNCC4)ccc23)cc1 |
| InChI | InChI=1S/C23H22F2N2O2/c1-23(24,25)18-6-8-19(9-7-18)29-21-4-2-3-16-15-17(5-10-20(16)21)22(28)27-13-11-26-12-14-27/h2-10,15,26H,11-14H2,1H3 |
| InChIKey | RHMGZJPDVZDDHD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |