C24H22F2I2N2O2 — CID 167034833
[5-[4-[fluoro(diiodo)methyl]phenoxy]naphthalen-2-yl]-[3-[(2-fluoroethylamino)methyl]azetidin-1-yl]methanone (PubChem CID 167034833) has the molecular formula C24H22F2I2N2O2 and a molecular weight of 662.26 g/mol. Its IUPAC name is [5-[4-[fluoro(diiodo)methyl]phenoxy]naphthalen-2-yl]-[3-[(2-fluoroethylamino)methyl]azetidin-1-yl]methanone.
| Compound Name | [5-[4-[fluoro(diiodo)methyl]phenoxy]naphthalen-2-yl]-[3-[(2-fluoroethylamino)methyl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 167034833 |
| Molecular Formula | C24H22F2I2N2O2 |
| Molecular Weight | 662.26 g/mol |
| Exact Mass | 661.97 |
| IUPAC Name | [5-[4-[fluoro(diiodo)methyl]phenoxy]naphthalen-2-yl]-[3-[(2-fluoroethylamino)methyl]azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc2c(Oc3ccc(C(F)(I)I)cc3)cccc2c1)N1CC(CNCCF)C1 |
| InChI | InChI=1S/C24H22F2I2N2O2/c25-10-11-29-13-16-14-30(15-16)23(31)18-4-9-21-17(12-18)2-1-3-22(21)32-20-7-5-19(6-8-20)24(26,27)28/h1-9,12,16,29H,10-11,13-15H2 |
| InChIKey | HLYCUGRIFZDPGH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.26 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|