C19H21IN2O4 — CID 174178648
4-[1-(1,3-dihydro-2-benzofuran-4-yl)ethoxy]-N-ethyl-5-(2-iodoacetyl)-1H-pyrrole-2-carboxamide (PubChem CID 174178648) has the molecular formula C19H21IN2O4 and a molecular weight of 468.29 g/mol. Its IUPAC name is 4-[1-(1,3-dihydro-2-benzofuran-4-yl)ethoxy]-N-ethyl-5-(2-iodoacetyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[1-(1,3-dihydro-2-benzofuran-4-yl)ethoxy]-N-ethyl-5-(2-iodoacetyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 174178648 |
| Molecular Formula | C19H21IN2O4 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 4-[1-(1,3-dihydro-2-benzofuran-4-yl)ethoxy]-N-ethyl-5-(2-iodoacetyl)-1H-pyrrole-2-carboxamide |
| SMILES | CCNC(=O)c1cc(OC(C)c2cccc3c2COC3)c(C(=O)CI)[nH]1 |
| InChI | InChI=1S/C19H21IN2O4/c1-3-21-19(24)15-7-17(18(22-15)16(23)8-20)26-11(2)13-6-4-5-12-9-25-10-14(12)13/h4-7,11,22H,3,8-10H2,1-2H3,(H,21,24) |
| InChIKey | RTFVIEPSDREUIW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|