C14H21ClN4 — CID 174180968
5-[4-(2-chloropropan-2-yl)-6-methylpyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 174180968) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is 5-[4-(2-chloropropan-2-yl)-6-methylpyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[4-(2-chloropropan-2-yl)-6-methylpyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 174180968 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-[4-(2-chloropropan-2-yl)-6-methylpyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Cc1cc(C(C)(C)Cl)nc(N2CC3CNCC3C2)n1 |
| InChI | InChI=1S/C14H21ClN4/c1-9-4-12(14(2,3)15)18-13(17-9)19-7-10-5-16-6-11(10)8-19/h4,10-11,16H,5-8H2,1-3H3 |
| InChIKey | ROXNRNQVBDBWIW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|