C29H30O4 — CID 174183235
[(9R,10S)-10-[(2,3-dimethylphenyl)-hydroxymethoxy]-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,3-dimethylbenzoate (PubChem CID 174183235) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(9R,10S)-10-[(2,3-dimethylphenyl)-hydroxymethoxy]-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,3-dimethylbenzoate.
| Compound Name | [(9R,10S)-10-[(2,3-dimethylphenyl)-hydroxymethoxy]-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 174183235 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(9R,10S)-10-[(2,3-dimethylphenyl)-hydroxymethoxy]-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,3-dimethylbenzoate |
| SMILES | Cc1cccc(C(=O)O[C@@H]2C3CC(c4ccccc43)[C@@H]2OC(O)c2cccc(C)c2C)c1C |
| InChI | InChI=1S/C29H30O4/c1-16-9-7-13-20(18(16)3)28(30)32-26-24-15-25(23-12-6-5-11-22(23)24)27(26)33-29(31)21-14-8-10-17(2)19(21)4/h5-14,24-28,30H,15H2,1-4H3/t24?,25?,26-,27+,28?/m0/s1 |
| InChIKey | NCOMELXMHWVDIW-NBFFJQNASA-N |
| XLogP | 5.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|