C11H22N2 — CID 174183986
N-[(Z)-hex-2-enyl]-N,2-dimethylpropanimidamide (PubChem CID 174183986) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N-[(Z)-hex-2-enyl]-N,2-dimethylpropanimidamide.
| Compound Name | N-[(Z)-hex-2-enyl]-N,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 174183986 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-[(Z)-hex-2-enyl]-N,2-dimethylpropanimidamide |
| SMILES | [H]/N=C(\C(C)C)N(C)C/C=C\CCC |
| InChI | InChI=1S/C11H22N2/c1-5-6-7-8-9-13(4)11(12)10(2)3/h7-8,10,12H,5-6,9H2,1-4H3/b8-7-,12-11+ |
| InChIKey | VCBUWXWIAJVRSM-OFALOCIGSA-N |
| XLogP | 2.91 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|