C14H16FNO5 — CID 174185825
5-(2-fluorophenoxy)-3a,4-dihydroxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 174185825) has the molecular formula C14H16FNO5 and a molecular weight of 297.28 g/mol. Its IUPAC name is 5-(2-fluorophenoxy)-3a,4-dihydroxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | 5-(2-fluorophenoxy)-3a,4-dihydroxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 174185825 |
| Molecular Formula | C14H16FNO5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-(2-fluorophenoxy)-3a,4-dihydroxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)N1CC2CC(Oc3ccccc3F)C(O)C2(O)C1 |
| InChI | InChI=1S/C14H16FNO5/c15-9-3-1-2-4-10(9)21-11-5-8-6-16(13(18)19)7-14(8,20)12(11)17/h1-4,8,11-12,17,20H,5-7H2,(H,18,19) |
| InChIKey | VIYZBLYPNZAAHS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |