About (2-fluorophenyl) 3-aminoazetidine-1-carboxylate
(2-fluorophenyl) 3-aminoazetidine-1-carboxylate (PubChem CID 83820757) has the molecular formula C10H11FN2O2
and a molecular weight of 210.21 g/mol. Its IUPAC name is (2-fluorophenyl) 3-aminoazetidine-1-carboxylate.
Molecular Properties
| Compound Name | (2-fluorophenyl) 3-aminoazetidine-1-carboxylate |
| PubChem CID | 83820757 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2-fluorophenyl) 3-aminoazetidine-1-carboxylate |
| SMILES | NC1CN(C(=O)Oc2ccccc2F)C1 |
| InChI | InChI=1S/C10H11FN2O2/c11-8-3-1-2-4-9(8)15-10(14)13-5-7(12)6-13/h1-4,7H,5-6,12H2 |
| InChIKey | MUSVBEQSZWTFQU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorophenyl) 3-aminoazetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) 3-aminoazetidine-1-carboxylate?
The IUPAC name of (2-fluorophenyl) 3-aminoazetidine-1-carboxylate (CID 83820757) is (2-fluorophenyl) 3-aminoazetidine-1-carboxylate.
What is the SMILES notation for (2-fluorophenyl) 3-aminoazetidine-1-carboxylate?
The canonical SMILES for (2-fluorophenyl) 3-aminoazetidine-1-carboxylate is NC1CN(C(=O)Oc2ccccc2F)C1.
What is the InChIKey of (2-fluorophenyl) 3-aminoazetidine-1-carboxylate?
The InChIKey is MUSVBEQSZWTFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O2/c11-8-3-1-2-4-9(8)15-10(14)13-5-7(12)6-13/h1-4,7H,5-6,12H2.
What are the key properties of (2-fluorophenyl) 3-aminoazetidine-1-carboxylate?
(2-fluorophenyl) 3-aminoazetidine-1-carboxylate has a molecular weight of 210.21 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) 3-aminoazetidine-1-carboxylate is sourced from PubChem (CID 83820757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).