C19H25FN2O2 — CID 110109807
1-[(3aS,4S,6aR)-4-(2-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-pyrrolidin-1-ylethanone (PubChem CID 110109807) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-[(3aS,4S,6aR)-4-(2-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-pyrrolidin-1-ylethanone.
| Compound Name | 1-[(3aS,4S,6aR)-4-(2-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 110109807 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-[(3aS,4S,6aR)-4-(2-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCCC1)N1C[C@@H]2CC[C@H](Oc3ccccc3F)[C@@H]2C1 |
| InChI | InChI=1S/C19H25FN2O2/c20-16-5-1-2-6-18(16)24-17-8-7-14-11-22(12-15(14)17)19(23)13-21-9-3-4-10-21/h1-2,5-6,14-15,17H,3-4,7-13H2/t14-,15+,17-/m0/s1 |
| InChIKey | DNEGLRLLYVPCMN-UXLLHSPISA-N |
| XLogP | 2.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |