C23H26FNO5 — CID 110121542
1-[(3aS,4S,6aR)-4-(3-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2,6-dimethoxyphenoxy)ethanone (PubChem CID 110121542) has the molecular formula C23H26FNO5 and a molecular weight of 415.46 g/mol. Its IUPAC name is 1-[(3aS,4S,6aR)-4-(3-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2,6-dimethoxyphenoxy)ethanone.
| Compound Name | 1-[(3aS,4S,6aR)-4-(3-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2,6-dimethoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 110121542 |
| Molecular Formula | C23H26FNO5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-[(3aS,4S,6aR)-4-(3-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-2-(2,6-dimethoxyphenoxy)ethanone |
| SMILES | COc1cccc(OC)c1OCC(=O)N1C[C@@H]2CC[C@H](Oc3cccc(F)c3)[C@@H]2C1 |
| InChI | InChI=1S/C23H26FNO5/c1-27-20-7-4-8-21(28-2)23(20)29-14-22(26)25-12-15-9-10-19(18(15)13-25)30-17-6-3-5-16(24)11-17/h3-8,11,15,18-19H,9-10,12-14H2,1-2H3/t15-,18+,19-/m0/s1 |
| InChIKey | GXNYQAVTPLZHBA-IPELMVKDSA-N |
| XLogP | 3.54 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |