C17H15FN4O3 — CID 174190500
1-(3-fluorophenyl)-3-[(5Z)-1-methyl-5-[(5-methylfuran-2-yl)methylidene]-4-oxoimidazolidin-2-ylidene]urea (PubChem CID 174190500) has the molecular formula C17H15FN4O3 and a molecular weight of 342.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[(5Z)-1-methyl-5-[(5-methylfuran-2-yl)methylidene]-4-oxoimidazolidin-2-ylidene]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[(5Z)-1-methyl-5-[(5-methylfuran-2-yl)methylidene]-4-oxoimidazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 174190500 |
| Molecular Formula | C17H15FN4O3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[(5Z)-1-methyl-5-[(5-methylfuran-2-yl)methylidene]-4-oxoimidazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(/C=C2/C(=O)NC(=NC(=O)Nc3cccc(F)c3)N2C)o1 |
| InChI | InChI=1S/C17H15FN4O3/c1-10-6-7-13(25-10)9-14-15(23)20-16(22(14)2)21-17(24)19-12-5-3-4-11(18)8-12/h3-9H,1-2H3,(H2,19,20,21,23,24)/b14-9- |
| InChIKey | CEUHGDWVJISBFX-ZROIWOOFSA-N |
| XLogP | 2.72 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|