C18H23ClN6O2S — CID 174190528
[1-[6-(3,4-diamino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methylcarbamic acid (PubChem CID 174190528) has the molecular formula C18H23ClN6O2S and a molecular weight of 422.94 g/mol. Its IUPAC name is [1-[6-(3,4-diamino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methylcarbamic acid.
| Compound Name | [1-[6-(3,4-diamino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 174190528 |
| Molecular Formula | C18H23ClN6O2S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [1-[6-(3,4-diamino-2-chlorophenyl)sulfanylpyrazin-2-yl]-4-methylpiperidin-4-yl]methylcarbamic acid |
| SMILES | CC1(CNC(=O)O)CCN(c2cncc(Sc3ccc(N)c(N)c3Cl)n2)CC1 |
| InChI | InChI=1S/C18H23ClN6O2S/c1-18(10-23-17(26)27)4-6-25(7-5-18)13-8-22-9-14(24-13)28-12-3-2-11(20)16(21)15(12)19/h2-3,8-9,23H,4-7,10,20-21H2,1H3,(H,26,27) |
| InChIKey | QMPIDASWQVHBEK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|