C4H8F2NP — CID 174192847
1-[(1R)-2,2-difluorocyclopropyl]-N-phosphanylmethanamine (PubChem CID 174192847) has the molecular formula C4H8F2NP and a molecular weight of 139.08 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluorocyclopropyl]-N-phosphanylmethanamine.
| Compound Name | 1-[(1R)-2,2-difluorocyclopropyl]-N-phosphanylmethanamine |
|---|---|
| PubChem CID | 174192847 |
| Molecular Formula | C4H8F2NP |
| Molecular Weight | 139.08 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | 1-[(1R)-2,2-difluorocyclopropyl]-N-phosphanylmethanamine |
| SMILES | FC1(F)C[C@@H]1CNP |
| InChI | InChI=1S/C4H8F2NP/c5-4(6)1-3(4)2-7-8/h3,7H,1-2,8H2/t3-/m1/s1 |
| InChIKey | WZPWDCYQAFAYEM-GSVOUGTGSA-N |
| XLogP | 1.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.08 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|