C4H7F2N — CID 21072530
(2,2-difluorocyclopropyl)methanamine (PubChem CID 21072530) has the molecular formula C4H7F2N and a molecular weight of 107.10 g/mol. Its IUPAC name is (2,2-difluorocyclopropyl)methanamine.
| Compound Name | (2,2-difluorocyclopropyl)methanamine |
|---|---|
| PubChem CID | 21072530 |
| Molecular Formula | C4H7F2N |
| Molecular Weight | 107.10 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | (2,2-difluorocyclopropyl)methanamine |
| SMILES | NCC1CC1(F)F |
| InChI | InChI=1S/C4H7F2N/c5-4(6)1-3(4)2-7/h3H,1-2,7H2 |
| InChIKey | ISMZEPBEQCSYFX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.10 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |