C35H34O4 — CID 174195865
[3-benzoyloxy-4-(2,5-dimethylphenyl)-1,6,7-trimethyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate (PubChem CID 174195865) has the molecular formula C35H34O4 and a molecular weight of 518.65 g/mol. Its IUPAC name is [3-benzoyloxy-4-(2,5-dimethylphenyl)-1,6,7-trimethyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate.
| Compound Name | [3-benzoyloxy-4-(2,5-dimethylphenyl)-1,6,7-trimethyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 174195865 |
| Molecular Formula | C35H34O4 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | [3-benzoyloxy-4-(2,5-dimethylphenyl)-1,6,7-trimethyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate |
| SMILES | Cc1ccc(C)c(C2c3cc(C)c(C)cc3C(C)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C35H34O4/c1-21-16-17-22(2)28(18-21)31-30-20-24(4)23(3)19-29(30)25(5)32(38-34(36)26-12-8-6-9-13-26)33(31)39-35(37)27-14-10-7-11-15-27/h6-20,25,31-33H,1-5H3 |
| InChIKey | MHBMLQYHIGEYDM-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |