C36H38O4P2 — CID 174195901
[(2R)-3-benzoyloxy-4-(2,5-dimethyl-4-methylphosphanylphenyl)-1,7-dimethyl-6-methylphosphanyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate (PubChem CID 174195901) has the molecular formula C36H38O4P2 and a molecular weight of 596.64 g/mol. Its IUPAC name is [(2R)-3-benzoyloxy-4-(2,5-dimethyl-4-methylphosphanylphenyl)-1,7-dimethyl-6-methylphosphanyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate.
| Compound Name | [(2R)-3-benzoyloxy-4-(2,5-dimethyl-4-methylphosphanylphenyl)-1,7-dimethyl-6-methylphosphanyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 174195901 |
| Molecular Formula | C36H38O4P2 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | [(2R)-3-benzoyloxy-4-(2,5-dimethyl-4-methylphosphanylphenyl)-1,7-dimethyl-6-methylphosphanyl-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate |
| SMILES | CPc1cc(C)c(C2c3cc(PC)c(C)cc3C(C)[C@@H](OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C36H38O4P2/c1-21-19-30(41-5)22(2)17-27(21)32-29-20-31(42-6)23(3)18-28(29)24(4)33(39-35(37)25-13-9-7-10-14-25)34(32)40-36(38)26-15-11-8-12-16-26/h7-20,24,32-34,41-42H,1-6H3/t24?,32?,33-,34?/m1/s1 |
| InChIKey | HZCPYEZCWRWUSS-JOIZAGFBSA-N |
| XLogP | 7.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|