About 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline
2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline (PubChem CID 174196684) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline.
Molecular Properties
| Compound Name | 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline |
| PubChem CID | 174196684 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline |
| SMILES | Cc1nc2c(cc1CN1CCCC1)=CCCC=2 |
| InChI | InChI=1S/C15H20N2/c1-12-14(11-17-8-4-5-9-17)10-13-6-2-3-7-15(13)16-12/h6-7,10H,2-5,8-9,11H2,1H3 |
| InChIKey | KBYRJNMTJXCDBF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline?
The IUPAC name of 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline (CID 174196684) is 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline.
What is the SMILES notation for 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline?
The canonical SMILES for 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline is Cc1nc2c(cc1CN1CCCC1)=CCCC=2.
What is the InChIKey of 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline?
The InChIKey is KBYRJNMTJXCDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-12-14(11-17-8-4-5-9-17)10-13-6-2-3-7-15(13)16-12/h6-7,10H,2-5,8-9,11H2,1H3.
What are the key properties of 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline?
2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline has a molecular weight of 228.34 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(pyrrolidin-1-ylmethyl)-6,7-dihydroquinoline is sourced from PubChem (CID 174196684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).