C14H24N2 — CID 100793985
1-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]piperidine (PubChem CID 100793985) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]piperidine.
| Compound Name | 1-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 100793985 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]piperidine |
| SMILES | CCn1c(C)cc(CN2CCCCC2)c1C |
| InChI | InChI=1S/C14H24N2/c1-4-16-12(2)10-14(13(16)3)11-15-8-6-5-7-9-15/h10H,4-9,11H2,1-3H3 |
| InChIKey | DQHZGMQQHNDFOY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |