C16H18ClN3O4 — CID 174197198
oxolan-2-ylmethyl 2-[5-(5-chloro-2-pyridinyl)-1-methylpyrazol-3-yl]oxyacetate (PubChem CID 174197198) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-[5-(5-chloro-2-pyridinyl)-1-methylpyrazol-3-yl]oxyacetate.
| Compound Name | oxolan-2-ylmethyl 2-[5-(5-chloro-2-pyridinyl)-1-methylpyrazol-3-yl]oxyacetate |
|---|---|
| PubChem CID | 174197198 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | oxolan-2-ylmethyl 2-[5-(5-chloro-2-pyridinyl)-1-methylpyrazol-3-yl]oxyacetate |
| SMILES | Cn1nc(OCC(=O)OCC2CCCO2)cc1-c1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H18ClN3O4/c1-20-14(13-5-4-11(17)8-18-13)7-15(19-20)23-10-16(21)24-9-12-3-2-6-22-12/h4-5,7-8,12H,2-3,6,9-10H2,1H3 |
| InChIKey | KLHJJKGKUBMXDN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |