C12H10BrF2N3O3S — CID 17420156
4-bromo-N'-(2,4-difluorophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide (PubChem CID 17420156) has the molecular formula C12H10BrF2N3O3S and a molecular weight of 394.20 g/mol. Its IUPAC name is 4-bromo-N'-(2,4-difluorophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(2,4-difluorophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 17420156 |
| Molecular Formula | C12H10BrF2N3O3S |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 4-bromo-N'-(2,4-difluorophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H10BrF2N3O3S/c1-18-6-7(13)4-10(18)12(19)16-17-22(20,21)11-3-2-8(14)5-9(11)15/h2-6,17H,1H3,(H,16,19) |
| InChIKey | LRBNLGTYVMZLAO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|