C28H30F3N5O3 — CID 174201796
2-[3,5-bis[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 174201796) has the molecular formula C28H30F3N5O3 and a molecular weight of 541.57 g/mol. Its IUPAC name is 2-[3,5-bis[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3,5-bis[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174201796 |
| Molecular Formula | C28H30F3N5O3 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-[3,5-bis[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]-1,2,4-triazol-4-yl]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OCCn1c(-c2ccc(C3=CCNCC3)cc2)nnc1-c1ccc(C2=CCNCC2)cc1 |
| InChI | InChI=1S/C26H29N5O.C2HF3O2/c32-18-17-31-25(23-5-1-19(2-6-23)21-9-13-27-14-10-21)29-30-26(31)24-7-3-20(4-8-24)22-11-15-28-16-12-22;3-2(4,5)1(6)7/h1-9,11,27-28,32H,10,12-18H2;(H,6,7) |
| InChIKey | BIEPUVYOURQYGU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |