C27H30F6N4O5 — CID 175769591
N-(2-methyl-4-piperazin-1-ylphenyl)-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175769591) has the molecular formula C27H30F6N4O5 and a molecular weight of 604.55 g/mol. Its IUPAC name is N-(2-methyl-4-piperazin-1-ylphenyl)-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(2-methyl-4-piperazin-1-ylphenyl)-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175769591 |
| Molecular Formula | C27H30F6N4O5 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | N-(2-methyl-4-piperazin-1-ylphenyl)-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(N2CCNCC2)ccc1NC(=O)c1ccc(C2=CCNCC2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28N4O.2C2HF3O2/c1-17-16-21(27-14-12-25-13-15-27)6-7-22(17)26-23(28)20-4-2-18(3-5-20)19-8-10-24-11-9-19;2*3-2(4,5)1(6)7/h2-8,16,24-25H,9-15H2,1H3,(H,26,28);2*(H,6,7) |
| InChIKey | ZKHDJRMUPKOFMN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|