C27H33F6N5O5 — CID 175769618
3-methyl-N-(2-methyl-4-piperazin-1-ylphenyl)-4-piperazin-1-ylbenzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175769618) has the molecular formula C27H33F6N5O5 and a molecular weight of 621.58 g/mol. Its IUPAC name is 3-methyl-N-(2-methyl-4-piperazin-1-ylphenyl)-4-piperazin-1-ylbenzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-methyl-N-(2-methyl-4-piperazin-1-ylphenyl)-4-piperazin-1-ylbenzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175769618 |
| Molecular Formula | C27H33F6N5O5 |
| Molecular Weight | 621.58 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | 3-methyl-N-(2-methyl-4-piperazin-1-ylphenyl)-4-piperazin-1-ylbenzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(N2CCNCC2)ccc1NC(=O)c1ccc(N2CCNCC2)c(C)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H31N5O.2C2HF3O2/c1-17-16-20(27-11-7-24-8-12-27)4-5-21(17)26-23(29)19-3-6-22(18(2)15-19)28-13-9-25-10-14-28;2*3-2(4,5)1(6)7/h3-6,15-16,24-25H,7-14H2,1-2H3,(H,26,29);2*(H,6,7) |
| InChIKey | HGYDMBYLUGKQBO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|