C20H27BN2O6 — CID 174205971
2-(ethoxycarbonylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]propanoic acid (PubChem CID 174205971) has the molecular formula C20H27BN2O6 and a molecular weight of 402.26 g/mol. Its IUPAC name is 2-(ethoxycarbonylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]propanoic acid.
| Compound Name | 2-(ethoxycarbonylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 174205971 |
| Molecular Formula | C20H27BN2O6 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-(ethoxycarbonylamino)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]propanoic acid |
| SMILES | CCOC(=O)NC(Cc1c[nH]c2cccc(B3OC(C)(C)C(C)(C)O3)c12)C(=O)O |
| InChI | InChI=1S/C20H27BN2O6/c1-6-27-18(26)23-15(17(24)25)10-12-11-22-14-9-7-8-13(16(12)14)21-28-19(2,3)20(4,5)29-21/h7-9,11,15,22H,6,10H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | RYYDLTNDSCRMLJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|