C20H15BrCl2N2O2 — CID 174207631
ethyl 8-(4-bromo-3,5-dichlorophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxylate (PubChem CID 174207631) has the molecular formula C20H15BrCl2N2O2 and a molecular weight of 466.16 g/mol. Its IUPAC name is ethyl 8-(4-bromo-3,5-dichlorophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxylate.
| Compound Name | ethyl 8-(4-bromo-3,5-dichlorophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxylate |
|---|---|
| PubChem CID | 174207631 |
| Molecular Formula | C20H15BrCl2N2O2 |
| Molecular Weight | 466.16 g/mol |
| Exact Mass | 463.97 |
| IUPAC Name | ethyl 8-(4-bromo-3,5-dichlorophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc2c1CCc1ccc(-c3cc(Cl)c(Br)c(Cl)c3)cc1-2 |
| InChI | InChI=1S/C20H15BrCl2N2O2/c1-2-27-20(26)19-13-6-5-10-3-4-11(7-14(10)18(13)24-25-19)12-8-15(22)17(21)16(23)9-12/h3-4,7-9H,2,5-6H2,1H3,(H,24,25) |
| InChIKey | YOGOAJHVOTVSEE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.16 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|