C14H15ClN2O3 — CID 174208014
2-[2-(chloromethyl)-3-(oxetan-2-ylmethyl)benzimidazol-5-yl]acetic acid (PubChem CID 174208014) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-(oxetan-2-ylmethyl)benzimidazol-5-yl]acetic acid.
| Compound Name | 2-[2-(chloromethyl)-3-(oxetan-2-ylmethyl)benzimidazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 174208014 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[2-(chloromethyl)-3-(oxetan-2-ylmethyl)benzimidazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc2nc(CCl)n(CC3CCO3)c2c1 |
| InChI | InChI=1S/C14H15ClN2O3/c15-7-13-16-11-2-1-9(6-14(18)19)5-12(11)17(13)8-10-3-4-20-10/h1-2,5,10H,3-4,6-8H2,(H,18,19) |
| InChIKey | HKTAKPQNWMVYTN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|