C16H19ClN2O3 — CID 175517448
2-[2-(chloromethyl)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl]-2-methylpropanoic acid (PubChem CID 175517448) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl]-2-methylpropanoic acid.
| Compound Name | 2-[2-(chloromethyl)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175517448 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-[2-(chloromethyl)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc2nc(CCl)n(C[C@@H]3CCO3)c2c1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-16(2,15(20)21)10-3-4-12-13(7-10)19(14(8-17)18-12)9-11-5-6-22-11/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | ACUJIUOAEDLCNY-NSHDSACASA-N |
| XLogP | 2.93 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|