C17H19ClN2O4 — CID 175587723
2-(chloromethyl)-7-(cyclopropylmethoxy)-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid (PubChem CID 175587723) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 2-(chloromethyl)-7-(cyclopropylmethoxy)-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid.
| Compound Name | 2-(chloromethyl)-7-(cyclopropylmethoxy)-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 175587723 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(chloromethyl)-7-(cyclopropylmethoxy)-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(OCC2CC2)c2nc(CCl)n(CC3CCO3)c2c1 |
| InChI | InChI=1S/C17H19ClN2O4/c18-7-15-19-16-13(20(15)8-12-3-4-23-12)5-11(17(21)22)6-14(16)24-9-10-1-2-10/h5-6,10,12H,1-4,7-9H2,(H,21,22) |
| InChIKey | RSMAMKLSGGKKJZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|