C16H21N3O4 — CID 170650541
7-[2-(dimethylamino)ethoxy]-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid (PubChem CID 170650541) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 7-[2-(dimethylamino)ethoxy]-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid.
| Compound Name | 7-[2-(dimethylamino)ethoxy]-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 170650541 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 7-[2-(dimethylamino)ethoxy]-3-(oxetan-2-ylmethyl)benzimidazole-5-carboxylic acid |
| SMILES | CN(C)CCOc1cc(C(=O)O)cc2c1ncn2CC1CCO1 |
| InChI | InChI=1S/C16H21N3O4/c1-18(2)4-6-23-14-8-11(16(20)21)7-13-15(14)17-10-19(13)9-12-3-5-22-12/h7-8,10,12H,3-6,9H2,1-2H3,(H,20,21) |
| InChIKey | WLKCZCOCJHYPEJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |