C15H15ClF2N2O4 — CID 171776908
methyl 2-(chloromethyl)-7-(difluoromethoxy)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate (PubChem CID 171776908) has the molecular formula C15H15ClF2N2O4 and a molecular weight of 360.74 g/mol. Its IUPAC name is methyl 2-(chloromethyl)-7-(difluoromethoxy)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 2-(chloromethyl)-7-(difluoromethoxy)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 171776908 |
| Molecular Formula | C15H15ClF2N2O4 |
| Molecular Weight | 360.74 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | methyl 2-(chloromethyl)-7-(difluoromethoxy)-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc(OC(F)F)c2nc(CCl)n(C[C@@H]3CCO3)c2c1 |
| InChI | InChI=1S/C15H15ClF2N2O4/c1-22-14(21)8-4-10-13(11(5-8)24-15(17)18)19-12(6-16)20(10)7-9-2-3-23-9/h4-5,9,15H,2-3,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | MPURVVYNUUQCNS-VIFPVBQESA-N |
| XLogP | 2.95 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|