C14H15ClFN3O2 — CID 177312307
methyl 3-[[(2S)-azetidin-2-yl]methyl]-2-(chloromethyl)-7-fluorobenzimidazole-5-carboxylate (PubChem CID 177312307) has the molecular formula C14H15ClFN3O2 and a molecular weight of 311.74 g/mol. Its IUPAC name is methyl 3-[[(2S)-azetidin-2-yl]methyl]-2-(chloromethyl)-7-fluorobenzimidazole-5-carboxylate.
| Compound Name | methyl 3-[[(2S)-azetidin-2-yl]methyl]-2-(chloromethyl)-7-fluorobenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 177312307 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 3-[[(2S)-azetidin-2-yl]methyl]-2-(chloromethyl)-7-fluorobenzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc(F)c2nc(CCl)n(C[C@@H]3CCN3)c2c1 |
| InChI | InChI=1S/C14H15ClFN3O2/c1-21-14(20)8-4-10(16)13-11(5-8)19(12(6-15)18-13)7-9-2-3-17-9/h4-5,9,17H,2-3,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | JMHZTNWWWSOJNW-VIFPVBQESA-N |
| XLogP | 2.06 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|