C17H26N4O5S — CID 174210352
2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]piperidin-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 174210352) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]piperidin-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]piperidin-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174210352 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]piperidin-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)C1CCN(c2nc(C(=O)O)cs2)CC1 |
| InChI | InChI=1S/C17H26N4O5S/c1-17(2,3)26-16(25)19-7-6-18-13(22)11-4-8-21(9-5-11)15-20-12(10-27-15)14(23)24/h10-11H,4-9H2,1-3H3,(H,18,22)(H,19,25)(H,23,24) |
| InChIKey | BNKJWALANQKSFU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|